C46H28O2 — CID 164787586
4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-[3-(2,3,4,5,6-pentadeuteriophenyl)-1-benzofuran-2-yl]dibenzofuran (PubChem CID 164787586) has the molecular formula C46H28O2 and a molecular weight of 622.79 g/mol. Its IUPAC name is 4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-[3-(2,3,4,5,6-pentadeuteriophenyl)-1-benzofuran-2-yl]dibenzofuran.
| Compound Name | 4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-[3-(2,3,4,5,6-pentadeuteriophenyl)-1-benzofuran-2-yl]dibenzofuran |
|---|---|
| PubChem CID | 164787586 |
| Molecular Formula | C46H28O2 |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-[3-(2,3,4,5,6-pentadeuteriophenyl)-1-benzofuran-2-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(-c3cccc4c3oc3c(-c5c6ccccc6c(-c6c([2H])c([2H])c([2H])c([2H])c6[2H])c6ccccc56)cccc34)oc3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H28O2/c1-3-15-29(16-4-1)41-31-19-7-9-21-33(31)43(34-22-10-8-20-32(34)41)38-26-13-24-35-36-25-14-27-39(45(36)48-44(35)38)46-42(30-17-5-2-6-18-30)37-23-11-12-28-40(37)47-46/h1-28H/i1D,2D,3D,4D,5D,6D,15D,16D,17D,18D |
| InChIKey | UBHYWMPUSKWMFM-IAYLIHTGSA-N |
| XLogP | 13.31 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|