C18H14Si — CID 164789486
3,7-diethynyl-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 164789486) has the molecular formula C18H14Si and a molecular weight of 258.40 g/mol. Its IUPAC name is 3,7-diethynyl-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 3,7-diethynyl-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 164789486 |
| Molecular Formula | C18H14Si |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3,7-diethynyl-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | C#Cc1ccc2c(c1)[Si](C)(C)c1cc(C#C)ccc1-2 |
| InChI | InChI=1S/C18H14Si/c1-5-13-7-9-15-16-10-8-14(6-2)12-18(16)19(3,4)17(15)11-13/h1-2,7-12H,3-4H3 |
| InChIKey | HUPDCBSEAPIWSH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|