C60H76N2O4 — CID 164792484
4-[6-(3-methoxy-3-methylbutoxy)hexyl]-N-[4-[4-(N-[4-[6-(3-methoxy-3-methylbutoxy)hexyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline (PubChem CID 164792484) has the molecular formula C60H76N2O4 and a molecular weight of 889.28 g/mol. Its IUPAC name is 4-[6-(3-methoxy-3-methylbutoxy)hexyl]-N-[4-[4-(N-[4-[6-(3-methoxy-3-methylbutoxy)hexyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline.
| Compound Name | 4-[6-(3-methoxy-3-methylbutoxy)hexyl]-N-[4-[4-(N-[4-[6-(3-methoxy-3-methylbutoxy)hexyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 164792484 |
| Molecular Formula | C60H76N2O4 |
| Molecular Weight | 889.28 g/mol |
| Exact Mass | 888.58 |
| IUPAC Name | 4-[6-(3-methoxy-3-methylbutoxy)hexyl]-N-[4-[4-(N-[4-[6-(3-methoxy-3-methylbutoxy)hexyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline |
| SMILES | COC(C)(C)CCOCCCCCCc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc(CCCCCCOCCC(C)(C)OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C60H76N2O4/c1-59(2,63-5)43-47-65-45-19-9-7-13-21-49-27-35-55(36-28-49)61(53-23-15-11-16-24-53)57-39-31-51(32-40-57)52-33-41-58(42-34-52)62(54-25-17-12-18-26-54)56-37-29-50(30-38-56)22-14-8-10-20-46-66-48-44-60(3,4)64-6/h11-12,15-18,23-42H,7-10,13-14,19-22,43-48H2,1-6H3 |
| InChIKey | ATSOLHFRELWRGI-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.28 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|