C11H12ClFN4O — CID 164792491
[3-(chloromethyl)-1-(6-fluoro-[1,3]oxazolo[5,4-b]pyridin-2-yl)azetidin-3-yl]methanamine (PubChem CID 164792491) has the molecular formula C11H12ClFN4O and a molecular weight of 270.69 g/mol. Its IUPAC name is [3-(chloromethyl)-1-(6-fluoro-[1,3]oxazolo[5,4-b]pyridin-2-yl)azetidin-3-yl]methanamine.
| Compound Name | [3-(chloromethyl)-1-(6-fluoro-[1,3]oxazolo[5,4-b]pyridin-2-yl)azetidin-3-yl]methanamine |
|---|---|
| PubChem CID | 164792491 |
| Molecular Formula | C11H12ClFN4O |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [3-(chloromethyl)-1-(6-fluoro-[1,3]oxazolo[5,4-b]pyridin-2-yl)azetidin-3-yl]methanamine |
| SMILES | NCC1(CCl)CN(c2nc3cc(F)cnc3o2)C1 |
| InChI | InChI=1S/C11H12ClFN4O/c12-3-11(4-14)5-17(6-11)10-16-8-1-7(13)2-15-9(8)18-10/h1-2H,3-6,14H2 |
| InChIKey | CQNWIGSJYGDJIG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|