About CID 164796124
CID 164796124 (PubChem CID 164796124) has the molecular formula C37H24IrN4+
and a molecular weight of 716.84 g/mol.
Molecular Properties
| Compound Name | CID 164796124 |
| PubChem CID | 164796124 |
| Molecular Formula | C37H24IrN4+ |
| Molecular Weight | 716.84 g/mol |
| Exact Mass | 717.16 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n(-c2[c-]c3c(cc2)c2cccc4c5ccccc5n3c24)c2ccccc21.[Ir+3].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H16N3.C11H8N.Ir/c1-27-16-28(24-12-5-4-11-23(24)27)17-13-14-19-21-9-6-8-20-18-7-2-3-10-22(18)29(26(20)21)25(19)15-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-14H,1H3;1-6,8-9H;/q2*-1;+3 |
| InChIKey | DHOWSFMCXSNYKY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 716.84 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164796124 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164796124?
The IUPAC name of CID 164796124 (CID 164796124) is not available.
What is the SMILES notation for CID 164796124?
The canonical SMILES for CID 164796124 is C[n+]1[c-]n(-c2[c-]c3c(cc2)c2cccc4c5ccccc5n3c24)c2ccccc21.[Ir+3].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 164796124?
The InChIKey is DHOWSFMCXSNYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N3.C11H8N.Ir/c1-27-16-28(24-12-5-4-11-23(24)27)17-13-14-19-21-9-6-8-20-18-7-2-3-10-22(18)29(26(20)21)25(19)15-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-14H,1H3;1-6,8-9H;/q2*-1;+3.
What are the key properties of CID 164796124?
CID 164796124 has a molecular weight of 716.84 g/mol, XLogP of 7.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164796124 is sourced from PubChem (CID 164796124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).