C25H29NOSi — CID 164796961
trimethyl-[8-(2-methylpropyl)-4-[5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-1-yl]silane (PubChem CID 164796961) has the molecular formula C25H29NOSi and a molecular weight of 390.62 g/mol. Its IUPAC name is trimethyl-[8-(2-methylpropyl)-4-[5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-1-yl]silane.
| Compound Name | trimethyl-[8-(2-methylpropyl)-4-[5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-1-yl]silane |
|---|---|
| PubChem CID | 164796961 |
| Molecular Formula | C25H29NOSi |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | trimethyl-[8-(2-methylpropyl)-4-[5-(trideuteriomethyl)-2-pyridinyl]dibenzofuran-1-yl]silane |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc([Si](C)(C)C)c3c2oc2ccc(CC(C)C)cc23)nc1 |
| InChI | InChI=1S/C25H29NOSi/c1-16(2)13-18-8-11-22-20(14-18)24-23(28(4,5)6)12-9-19(25(24)27-22)21-10-7-17(3)15-26-21/h7-12,14-16H,13H2,1-6H3/i3D3 |
| InChIKey | KZFZRKOVQIDCLA-HPRDVNIFSA-N |
| XLogP | 6.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|