C51H39N3O — CID 164797633
2-[9-(4-cyclohexylphenyl)dibenzofuran-3-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 164797633) has the molecular formula C51H39N3O and a molecular weight of 709.89 g/mol. Its IUPAC name is 2-[9-(4-cyclohexylphenyl)dibenzofuran-3-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[9-(4-cyclohexylphenyl)dibenzofuran-3-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164797633 |
| Molecular Formula | C51H39N3O |
| Molecular Weight | 709.89 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 2-[9-(4-cyclohexylphenyl)dibenzofuran-3-yl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5c(c4)oc4cccc(-c6ccc(C7CCCCC7)cc6)c45)n3)cc2)cc1 |
| InChI | InChI=1S/C51H39N3O/c1-4-11-34(12-5-1)37-19-25-40(26-20-37)44-17-10-18-46-48(44)45-32-31-43(33-47(45)55-46)51-53-49(41-27-21-38(22-28-41)35-13-6-2-7-14-35)52-50(54-51)42-29-23-39(24-30-42)36-15-8-3-9-16-36/h2-3,6-10,13-34H,1,4-5,11-12H2 |
| InChIKey | JNZHAVSSJYEZKW-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.89 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |