C44H28N4O — CID 164798196
7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 164798196) has the molecular formula C44H28N4O and a molecular weight of 628.74 g/mol. Its IUPAC name is 7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 164798196 |
| Molecular Formula | C44H28N4O |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 7-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-4-phenyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5c(c4)oc4nccc(-c6ccccc6)c45)n3)cc2)cc1 |
| InChI | InChI=1S/C44H28N4O/c1-4-10-29(11-5-1)31-16-20-34(21-17-31)41-46-42(35-22-18-32(19-23-35)30-12-6-2-7-13-30)48-43(47-41)36-24-25-38-39(28-36)49-44-40(38)37(26-27-45-44)33-14-8-3-9-15-33/h1-28H |
| InChIKey | GWGQLKKCOVJXMP-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |