C30H18N2O — CID 164803382
19-[5-(trideuteriomethyl)-2-pyridinyl]-4-oxa-15-azaheptacyclo[13.10.1.02,14.03,11.05,10.016,21.022,26]hexacosa-1(25),2(14),3(11),5,7,9,12,16(21),17,19,22(26),23-dodecaene (PubChem CID 164803382) has the molecular formula C30H18N2O and a molecular weight of 425.51 g/mol. Its IUPAC name is 19-[5-(trideuteriomethyl)-2-pyridinyl]-4-oxa-15-azaheptacyclo[13.10.1.02,14.03,11.05,10.016,21.022,26]hexacosa-1(25),2(14),3(11),5,7,9,12,16(21),17,19,22(26),23-dodecaene.
| Compound Name | 19-[5-(trideuteriomethyl)-2-pyridinyl]-4-oxa-15-azaheptacyclo[13.10.1.02,14.03,11.05,10.016,21.022,26]hexacosa-1(25),2(14),3(11),5,7,9,12,16(21),17,19,22(26),23-dodecaene |
|---|---|
| PubChem CID | 164803382 |
| Molecular Formula | C30H18N2O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 19-[5-(trideuteriomethyl)-2-pyridinyl]-4-oxa-15-azaheptacyclo[13.10.1.02,14.03,11.05,10.016,21.022,26]hexacosa-1(25),2(14),3(11),5,7,9,12,16(21),17,19,22(26),23-dodecaene |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc3c(c2)c2cccc4c5c6oc7ccccc7c6ccc5n3c24)nc1 |
| InChI | InChI=1S/C30H18N2O/c1-17-9-12-24(31-16-17)18-10-13-25-23(15-18)20-6-4-7-22-28-26(32(25)29(20)22)14-11-21-19-5-2-3-8-27(19)33-30(21)28/h2-16H,1H3/i1D3 |
| InChIKey | LMCKNVKPXJPJAT-FIBGUPNXSA-N |
| XLogP | 8.11 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |