C31H20N2O2 — CID 158805068
11-[3-[5-(trideuteriomethyl)-2-pyridinyl]phenoxy]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14(19),15,17,20-decaene (PubChem CID 158805068) has the molecular formula C31H20N2O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is 11-[3-[5-(trideuteriomethyl)-2-pyridinyl]phenoxy]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14(19),15,17,20-decaene.
| Compound Name | 11-[3-[5-(trideuteriomethyl)-2-pyridinyl]phenoxy]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14(19),15,17,20-decaene |
|---|---|
| PubChem CID | 158805068 |
| Molecular Formula | C31H20N2O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 11-[3-[5-(trideuteriomethyl)-2-pyridinyl]phenoxy]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1,4,6,8,10,12,14(19),15,17,20-decaene |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cccc(Oc3cc4c(ccc5cccnc54)c4oc5ccccc5c34)c2)nc1 |
| InChI | InChI=1S/C31H20N2O2/c1-19-11-14-26(33-18-19)21-6-4-8-22(16-21)34-28-17-25-23(13-12-20-7-5-15-32-30(20)25)31-29(28)24-9-2-3-10-27(24)35-31/h2-18H,1H3/i1D3 |
| InChIKey | HYHLENMIPFKANG-FIBGUPNXSA-N |
| XLogP | 8.45 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|