C34H18N2O2Pt — CID 164721112
CID 164721112 (PubChem CID 164721112) has the molecular formula C34H18N2O2Pt and a molecular weight of 681.61 g/mol.
| Compound Name | CID 164721112 |
|---|---|
| PubChem CID | 164721112 |
| Molecular Formula | C34H18N2O2Pt |
| Molecular Weight | 681.61 g/mol |
| Exact Mass | 681.10 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(ccc4cccnc43)c3oc4ccccc4c23)cccc1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C34H18N2O2.Pt/c1-2-8-24-20-36-29(18-22(24)7-1)23-9-5-11-25(17-23)37-31-19-28-26(15-14-21-10-6-16-35-33(21)28)34-32(31)27-12-3-4-13-30(27)38-34;/h1-16,18,20H;/q-2;+2 |
| InChIKey | RXTCWXIVDXHKAD-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.61 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|