C47H30N2O3 — CID 164803737
4,5,6,7-tetradeuterio-2-[3-[3-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-9-yl)phenyl]-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole (PubChem CID 164803737) has the molecular formula C47H30N2O3 and a molecular weight of 678.82 g/mol. Its IUPAC name is 4,5,6,7-tetradeuterio-2-[3-[3-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-9-yl)phenyl]-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 4,5,6,7-tetradeuterio-2-[3-[3-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-9-yl)phenyl]-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 164803737 |
| Molecular Formula | C47H30N2O3 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | 4,5,6,7-tetradeuterio-2-[3-[3-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-9-yl)phenyl]-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole |
| SMILES | [2H]c1c([2H])c([2H])c2oc(-c3cc(-c4cccc(-c5ccc6c(c5)C(C)(C)c5cc7oc8ccccc8c7cc5-6)c4)cc(-c4nc5c([2H])c([2H])c([2H])c([2H])c5o4)c3)nc2c1[2H] |
| InChI | InChI=1S/C47H30N2O3/c1-47(2)37-24-29(18-19-33(37)35-25-36-34-12-3-6-15-41(34)50-44(36)26-38(35)47)27-10-9-11-28(20-27)30-21-31(45-48-39-13-4-7-16-42(39)51-45)23-32(22-30)46-49-40-14-5-8-17-43(40)52-46/h3-26H,1-2H3/i4D,5D,7D,8D,13D,14D,16D,17D |
| InChIKey | YEJDVNCCKBUBNH-IPCMLPKISA-N |
| XLogP | 12.84 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |