C41H28N2O2 — CID 164803847
4,5,6,7-tetradeuterio-2-[3-(9,9-dimethyl-7-phenylfluoren-2-yl)-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole (PubChem CID 164803847) has the molecular formula C41H28N2O2 and a molecular weight of 588.74 g/mol. Its IUPAC name is 4,5,6,7-tetradeuterio-2-[3-(9,9-dimethyl-7-phenylfluoren-2-yl)-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 4,5,6,7-tetradeuterio-2-[3-(9,9-dimethyl-7-phenylfluoren-2-yl)-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 164803847 |
| Molecular Formula | C41H28N2O2 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 4,5,6,7-tetradeuterio-2-[3-(9,9-dimethyl-7-phenylfluoren-2-yl)-5-(4,5,6,7-tetradeuterio-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole |
| SMILES | [2H]c1c([2H])c([2H])c2oc(-c3cc(-c4ccc5c(c4)C(C)(C)c4cc(-c6ccccc6)ccc4-5)cc(-c4nc5c([2H])c([2H])c([2H])c([2H])c5o4)c3)nc2c1[2H] |
| InChI | InChI=1S/C41H28N2O2/c1-41(2)33-23-26(25-10-4-3-5-11-25)16-18-31(33)32-19-17-27(24-34(32)41)28-20-29(39-42-35-12-6-8-14-37(35)44-39)22-30(21-28)40-43-36-13-7-9-15-38(36)45-40/h3-24H,1-2H3/i6D,7D,8D,9D,12D,13D,14D,15D |
| InChIKey | GWGRXVDVGPLSSI-VHOGMFLNSA-N |
| XLogP | 10.94 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |