C43H26N4O2 — CID 164803811
2-[3-(1,3-benzoxazol-2-yl)-5-[4-(9,9-dimethylfluoren-2-yl)-2,6-diisocyanophenyl]phenyl]-1,3-benzoxazole (PubChem CID 164803811) has the molecular formula C43H26N4O2 and a molecular weight of 630.71 g/mol. Its IUPAC name is 2-[3-(1,3-benzoxazol-2-yl)-5-[4-(9,9-dimethylfluoren-2-yl)-2,6-diisocyanophenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-(1,3-benzoxazol-2-yl)-5-[4-(9,9-dimethylfluoren-2-yl)-2,6-diisocyanophenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 164803811 |
| Molecular Formula | C43H26N4O2 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 2-[3-(1,3-benzoxazol-2-yl)-5-[4-(9,9-dimethylfluoren-2-yl)-2,6-diisocyanophenyl]phenyl]-1,3-benzoxazole |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc([N+]#[C-])c1-c1cc(-c2nc3ccccc3o2)cc(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C43H26N4O2/c1-43(2)32-12-6-5-11-30(32)31-18-17-25(22-33(31)43)26-23-36(44-3)40(37(24-26)45-4)27-19-28(41-46-34-13-7-9-15-38(34)48-41)21-29(20-27)42-47-35-14-8-10-16-39(35)49-42/h5-24H,1-2H3 |
| InChIKey | GTLREEMIWCARLP-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|