C40H30N4 — CID 164805052
3,4-diphenyl-15-[2-(3-pyridin-2-ylphenyl)propan-2-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene (PubChem CID 164805052) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 3,4-diphenyl-15-[2-(3-pyridin-2-ylphenyl)propan-2-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene.
| Compound Name | 3,4-diphenyl-15-[2-(3-pyridin-2-ylphenyl)propan-2-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 164805052 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 3,4-diphenyl-15-[2-(3-pyridin-2-ylphenyl)propan-2-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
| SMILES | CC(C)(c1cccc(-c2ccccn2)c1)c1ccc2c(c1)c1ncccc1c1nc(-c3ccccc3)c(-c3ccccc3)n21 |
| InChI | InChI=1S/C40H30N4/c1-40(2,30-18-11-17-29(25-30)34-20-9-10-23-41-34)31-21-22-35-33(26-31)37-32(19-12-24-42-37)39-43-36(27-13-5-3-6-14-27)38(44(35)39)28-15-7-4-8-16-28/h3-26H,1-2H3 |
| InChIKey | RNVKBAKVYWOKEX-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|