C42H27N5 — CID 58038117
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylimidazo[1,2-f]phenanthridine (PubChem CID 58038117) has the molecular formula C42H27N5 and a molecular weight of 601.71 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylimidazo[1,2-f]phenanthridine.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 58038117 |
| Molecular Formula | C42H27N5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,3-diphenylimidazo[1,2-f]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)c3ccccc3c3nc(-c5ccccc5)c(-c5ccccc5)n43)n2)cc1 |
| InChI | InChI=1S/C42H27N5/c1-5-15-28(16-6-1)37-38(29-17-7-2-8-18-29)47-36-26-25-32(27-35(36)33-23-13-14-24-34(33)42(47)43-37)41-45-39(30-19-9-3-10-20-30)44-40(46-41)31-21-11-4-12-22-31/h1-27H |
| InChIKey | PJVRSHFHYZEIPY-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|