C21H26BN4O2 — CID 164806514
CID 164806514 (PubChem CID 164806514) has the molecular formula C21H26BN4O2 and a molecular weight of 377.28 g/mol.
| Compound Name | CID 164806514 |
|---|---|
| PubChem CID | 164806514 |
| Molecular Formula | C21H26BN4O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | — |
| SMILES | Cc1cnn(C)c1-c1ccc(NC(=O)[C@@H](N[B]C=O)C(C2CC2)C2CC2)cc1 |
| InChI | InChI=1S/C21H26BN4O2/c1-13-11-23-26(2)20(13)16-7-9-17(10-8-16)24-21(28)19(25-22-12-27)18(14-3-4-14)15-5-6-15/h7-12,14-15,18-19,25H,3-6H2,1-2H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | MAEHZGXCXZCHPH-IBGZPJMESA-N |
| XLogP | 2.54 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|