C31H48N4O4Si — CID 175152196
tert-butyl N-[1,1-dicyclopropyl-3-[4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethyl)anilino]-3-oxopropan-2-yl]carbamate (PubChem CID 175152196) has the molecular formula C31H48N4O4Si and a molecular weight of 568.84 g/mol. Its IUPAC name is tert-butyl N-[1,1-dicyclopropyl-3-[4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethyl)anilino]-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,1-dicyclopropyl-3-[4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethyl)anilino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175152196 |
| Molecular Formula | C31H48N4O4Si |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | tert-butyl N-[1,1-dicyclopropyl-3-[4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethyl)anilino]-3-oxopropan-2-yl]carbamate |
| SMILES | Cc1cnn(C)c1-c1ccc(NC(=O)C(NC(=O)OC(C)(C)C)C(C2CC2)C2CC2)cc1COCC[Si](C)(C)C |
| InChI | InChI=1S/C31H48N4O4Si/c1-20-18-32-35(5)28(20)25-14-13-24(17-23(25)19-38-15-16-40(6,7)8)33-29(36)27(34-30(37)39-31(2,3)4)26(21-9-10-21)22-11-12-22/h13-14,17-18,21-22,26-27H,9-12,15-16,19H2,1-8H3,(H,33,36)(H,34,37) |
| InChIKey | YBXUNYYTUBHPHB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|