C20H28BrN3O4 — CID 166888708
tert-butyl N-[1-[(6-bromo-5-methoxy-3-pyridinyl)amino]-3,3-dicyclopropyl-1-oxopropan-2-yl]carbamate (PubChem CID 166888708) has the molecular formula C20H28BrN3O4 and a molecular weight of 454.37 g/mol. Its IUPAC name is tert-butyl N-[1-[(6-bromo-5-methoxy-3-pyridinyl)amino]-3,3-dicyclopropyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(6-bromo-5-methoxy-3-pyridinyl)amino]-3,3-dicyclopropyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 166888708 |
| Molecular Formula | C20H28BrN3O4 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | tert-butyl N-[1-[(6-bromo-5-methoxy-3-pyridinyl)amino]-3,3-dicyclopropyl-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cc(NC(=O)C(NC(=O)OC(C)(C)C)C(C2CC2)C2CC2)cnc1Br |
| InChI | InChI=1S/C20H28BrN3O4/c1-20(2,3)28-19(26)24-16(15(11-5-6-11)12-7-8-12)18(25)23-13-9-14(27-4)17(21)22-10-13/h9-12,15-16H,5-8H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | FTEIFKKOHXDVKO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|