C25H37BrClN3O3 — CID 175433303
tert-butyl N-[(2S)-1-[(5-bromo-6-chloro-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate (PubChem CID 175433303) has the molecular formula C25H37BrClN3O3 and a molecular weight of 542.95 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(5-bromo-6-chloro-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(5-bromo-6-chloro-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175433303 |
| Molecular Formula | C25H37BrClN3O3 |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(5-bromo-6-chloro-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)Nc1ccc(Br)c(Cl)n1)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H37BrClN3O3/c1-25(2,3)33-24(32)30-21(23(31)29-19-15-14-18(26)22(27)28-19)20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h14-17,20-21H,4-13H2,1-3H3,(H,30,32)(H,28,29,31)/t21-/m0/s1 |
| InChIKey | MOCURMHCONXSSS-NRFANRHFSA-N |
| XLogP | 7.11 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|