C22H33ClN2O3 — CID 176577409
tert-butyl N-[(1R)-2-[3-(4-chlorophenyl)propylamino]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 176577409) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-[3-(4-chlorophenyl)propylamino]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-[3-(4-chlorophenyl)propylamino]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 176577409 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl N-[(1R)-2-[3-(4-chlorophenyl)propylamino]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)NCCCc1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H33ClN2O3/c1-22(2,3)28-21(27)25-19(17-9-5-4-6-10-17)20(26)24-15-7-8-16-11-13-18(23)14-12-16/h11-14,17,19H,4-10,15H2,1-3H3,(H,24,26)(H,25,27)/t19-/m1/s1 |
| InChIKey | QHTZMBAENPMUCU-LJQANCHMSA-N |
| XLogP | 4.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|