C20H36N2O5 — CID 100747329
tert-butyl N-[(1S)-2-[3-[(1R,2S)-2-hydroxycyclopentyl]propylamino]-1-(oxan-4-yl)-2-oxoethyl]carbamate (PubChem CID 100747329) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[3-[(1R,2S)-2-hydroxycyclopentyl]propylamino]-1-(oxan-4-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[3-[(1R,2S)-2-hydroxycyclopentyl]propylamino]-1-(oxan-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 100747329 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | tert-butyl N-[(1S)-2-[3-[(1R,2S)-2-hydroxycyclopentyl]propylamino]-1-(oxan-4-yl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NCCC[C@H]1CCC[C@@H]1O)C1CCOCC1 |
| InChI | InChI=1S/C20H36N2O5/c1-20(2,3)27-19(25)22-17(15-9-12-26-13-10-15)18(24)21-11-5-7-14-6-4-8-16(14)23/h14-17,23H,4-13H2,1-3H3,(H,21,24)(H,22,25)/t14-,16+,17+/m1/s1 |
| InChIKey | YYUFQYCHUNYNMO-PVAVHDDUSA-N |
| XLogP | 2.36 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|