C20H30N2O5 — CID 119040474
tert-butyl N-[2-(5-ethyl-2-hydroxyanilino)-1-(oxan-4-yl)-2-oxoethyl]carbamate (PubChem CID 119040474) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl N-[2-(5-ethyl-2-hydroxyanilino)-1-(oxan-4-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-ethyl-2-hydroxyanilino)-1-(oxan-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 119040474 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl N-[2-(5-ethyl-2-hydroxyanilino)-1-(oxan-4-yl)-2-oxoethyl]carbamate |
| SMILES | CCc1ccc(O)c(NC(=O)C(NC(=O)OC(C)(C)C)C2CCOCC2)c1 |
| InChI | InChI=1S/C20H30N2O5/c1-5-13-6-7-16(23)15(12-13)21-18(24)17(14-8-10-26-11-9-14)22-19(25)27-20(2,3)4/h6-7,12,14,17,23H,5,8-11H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | LYWHZKAFKWXZRO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|