C36H24BN3O — CID 164806676
15,21-diphenyl-9-(trideuteriomethyl)-6-oxa-8,15,21-triaza-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2(14),3,5(13),7(12),8,10,16,18,20(28),22,24,26-dodecaene (PubChem CID 164806676) has the molecular formula C36H24BN3O and a molecular weight of 528.44 g/mol. Its IUPAC name is 15,21-diphenyl-9-(trideuteriomethyl)-6-oxa-8,15,21-triaza-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2(14),3,5(13),7(12),8,10,16,18,20(28),22,24,26-dodecaene.
| Compound Name | 15,21-diphenyl-9-(trideuteriomethyl)-6-oxa-8,15,21-triaza-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2(14),3,5(13),7(12),8,10,16,18,20(28),22,24,26-dodecaene |
|---|---|
| PubChem CID | 164806676 |
| Molecular Formula | C36H24BN3O |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 15,21-diphenyl-9-(trideuteriomethyl)-6-oxa-8,15,21-triaza-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2(14),3,5(13),7(12),8,10,16,18,20(28),22,24,26-dodecaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1ccc3c(c12)N(c1ccccc1)c1cccc2c1B3c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C36H24BN3O/c1-23-19-20-26-33-32(41-36(26)38-23)22-21-28-35(33)40(25-13-6-3-7-14-25)31-18-10-17-30-34(31)37(28)27-15-8-9-16-29(27)39(30)24-11-4-2-5-12-24/h2-22H,1H3/i1D3 |
| InChIKey | UYKMWPIAXXMWLF-FIBGUPNXSA-N |
| XLogP | 7.37 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|