C37H25BN2O — CID 164806719
15,21-diphenyl-11-(trideuteriomethyl)-3-oxa-15,21-diaza-1-boraheptacyclo[14.11.1.02,14.04,13.05,10.020,28.022,27]octacosa-2(14),4(13),5,7,9,11,16,18,20(28),22,24,26-dodecaene (PubChem CID 164806719) has the molecular formula C37H25BN2O and a molecular weight of 527.45 g/mol. Its IUPAC name is 15,21-diphenyl-11-(trideuteriomethyl)-3-oxa-15,21-diaza-1-boraheptacyclo[14.11.1.02,14.04,13.05,10.020,28.022,27]octacosa-2(14),4(13),5,7,9,11,16,18,20(28),22,24,26-dodecaene.
| Compound Name | 15,21-diphenyl-11-(trideuteriomethyl)-3-oxa-15,21-diaza-1-boraheptacyclo[14.11.1.02,14.04,13.05,10.020,28.022,27]octacosa-2(14),4(13),5,7,9,11,16,18,20(28),22,24,26-dodecaene |
|---|---|
| PubChem CID | 164806719 |
| Molecular Formula | C37H25BN2O |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 15,21-diphenyl-11-(trideuteriomethyl)-3-oxa-15,21-diaza-1-boraheptacyclo[14.11.1.02,14.04,13.05,10.020,28.022,27]octacosa-2(14),4(13),5,7,9,11,16,18,20(28),22,24,26-dodecaene |
| SMILES | [2H]C([2H])([2H])c1cc2c3c(oc2c2ccccc12)B1c2ccccc2N(c2ccccc2)c2cccc(c21)N3c1ccccc1 |
| InChI | InChI=1S/C37H25BN2O/c1-24-23-29-35-37(41-36(29)28-18-9-8-17-27(24)28)38-30-19-10-11-20-31(30)39(25-13-4-2-5-14-25)32-21-12-22-33(34(32)38)40(35)26-15-6-3-7-16-26/h2-23H,1H3/i1D3 |
| InChIKey | CQLHVLYBXBUNHQ-FIBGUPNXSA-N |
| XLogP | 7.98 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|