C32H22BN3S — CID 164806713
8,14-diphenyl-18-(trideuteriomethyl)-22-thia-8,14,20-triaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),16(21),17,19-decaene (PubChem CID 164806713) has the molecular formula C32H22BN3S and a molecular weight of 494.45 g/mol. Its IUPAC name is 8,14-diphenyl-18-(trideuteriomethyl)-22-thia-8,14,20-triaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),16(21),17,19-decaene.
| Compound Name | 8,14-diphenyl-18-(trideuteriomethyl)-22-thia-8,14,20-triaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),16(21),17,19-decaene |
|---|---|
| PubChem CID | 164806713 |
| Molecular Formula | C32H22BN3S |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 8,14-diphenyl-18-(trideuteriomethyl)-22-thia-8,14,20-triaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),16(21),17,19-decaene |
| SMILES | [2H]C([2H])([2H])c1cnc2sc3c(c2c1)N(c1ccccc1)c1cccc2c1B3c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C32H22BN3S/c1-21-19-24-30-31(37-32(24)34-20-21)33-25-15-8-9-16-26(25)35(22-11-4-2-5-12-22)27-17-10-18-28(29(27)33)36(30)23-13-6-3-7-14-23/h2-20H,1H3/i1D3 |
| InChIKey | DOBGBEQUKYYUTB-FIBGUPNXSA-N |
| XLogP | 6.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|