C15H9NO4 — CID 164808134
1-[(E)-3-(2,5-dioxabicyclo[4.4.0]deca-1(6),7,9-trien-3-yn-8-yl)prop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 164808134) has the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-[(E)-3-(2,5-dioxabicyclo[4.4.0]deca-1(6),7,9-trien-3-yn-8-yl)prop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-[(E)-3-(2,5-dioxabicyclo[4.4.0]deca-1(6),7,9-trien-3-yn-8-yl)prop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 164808134 |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 1-[(E)-3-(2,5-dioxabicyclo[4.4.0]deca-1(6),7,9-trien-3-yn-8-yl)prop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | O=C1C=CCN1C(=O)/C=C/c1ccc2c(c1)OC#CO2 |
| InChI | InChI=1S/C15H9NO4/c17-14-2-1-7-16(14)15(18)6-4-11-3-5-12-13(10-11)20-9-8-19-12/h1-6,10H,7H2/b6-4+ |
| InChIKey | ZJOUUBZFXHLISW-GQCTYLIASA-N |
| XLogP | 1.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|