C26H23N3O2SSeSi — CID 164809206
(5E)-1-methyl-5-[(5-spiro[benzo[b][1,4]benzazasiline-10,1'-silolane]-5-ylselenophen-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 164809206) has the molecular formula C26H23N3O2SSeSi and a molecular weight of 548.60 g/mol. Its IUPAC name is (5E)-1-methyl-5-[(5-spiro[benzo[b][1,4]benzazasiline-10,1'-silolane]-5-ylselenophen-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-methyl-5-[(5-spiro[benzo[b][1,4]benzazasiline-10,1'-silolane]-5-ylselenophen-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 164809206 |
| Molecular Formula | C26H23N3O2SSeSi |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | (5E)-1-methyl-5-[(5-spiro[benzo[b][1,4]benzazasiline-10,1'-silolane]-5-ylselenophen-2-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)/C(=C/c2ccc(N3c4ccccc4[Si]4(CCCC4)c4ccccc43)[se]2)C(=O)NC1=S |
| InChI | InChI=1S/C26H23N3O2SSeSi/c1-28-25(31)18(24(30)27-26(28)32)16-17-12-13-23(33-17)29-19-8-2-4-10-21(19)34(14-6-7-15-34)22-11-5-3-9-20(22)29/h2-5,8-13,16H,6-7,14-15H2,1H3,(H,27,30,32)/b18-16+ |
| InChIKey | ATHAXNFJTNMHTF-FBMGVBCBSA-N |
| XLogP | 3.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|