C29H36FN6O2P — CID 164809719
1-[4-diethylphosphoryl-3-(methylamino)phenyl]-3-[(4S)-2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]imidazol-2-one (PubChem CID 164809719) has the molecular formula C29H36FN6O2P and a molecular weight of 550.62 g/mol. Its IUPAC name is 1-[4-diethylphosphoryl-3-(methylamino)phenyl]-3-[(4S)-2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]imidazol-2-one.
| Compound Name | 1-[4-diethylphosphoryl-3-(methylamino)phenyl]-3-[(4S)-2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]imidazol-2-one |
|---|---|
| PubChem CID | 164809719 |
| Molecular Formula | C29H36FN6O2P |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 1-[4-diethylphosphoryl-3-(methylamino)phenyl]-3-[(4S)-2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]imidazol-2-one |
| SMILES | CCP(=O)(CC)c1ccc(-n2ccn(-c3c4c(nn3-c3cc(C)c(F)c(C)c3)CCN[C@H]4C)c2=O)cc1NC |
| InChI | InChI=1S/C29H36FN6O2P/c1-7-39(38,8-2)25-10-9-21(17-24(25)31-6)34-13-14-35(29(34)37)28-26-20(5)32-12-11-23(26)33-36(28)22-15-18(3)27(30)19(4)16-22/h9-10,13-17,20,31-32H,7-8,11-12H2,1-6H3/t20-/m0/s1 |
| InChIKey | FJFNTFNCBUFFFY-FQEVSTJZSA-N |
| XLogP | 4.85 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|