C26H28FN5O3S — CID 170167264
1-[2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-3-[4-(methylsulfonylmethyl)phenyl]imidazol-2-one (PubChem CID 170167264) has the molecular formula C26H28FN5O3S and a molecular weight of 509.61 g/mol. Its IUPAC name is 1-[2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-3-[4-(methylsulfonylmethyl)phenyl]imidazol-2-one.
| Compound Name | 1-[2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-3-[4-(methylsulfonylmethyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 170167264 |
| Molecular Formula | C26H28FN5O3S |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 1-[2-(4-fluoro-3,5-dimethylphenyl)-4-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-3-[4-(methylsulfonylmethyl)phenyl]imidazol-2-one |
| SMILES | Cc1cc(-n2nc3c(c2-n2ccn(-c4ccc(CS(C)(=O)=O)cc4)c2=O)C(C)NCC3)cc(C)c1F |
| InChI | InChI=1S/C26H28FN5O3S/c1-16-13-21(14-17(2)24(16)27)32-25(23-18(3)28-10-9-22(23)29-32)31-12-11-30(26(31)33)20-7-5-19(6-8-20)15-36(4,34)35/h5-8,11-14,18,28H,9-10,15H2,1-4H3 |
| InChIKey | WCZHXKPYKSUMFV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |