C9H5N3O — CID 164813193
8-oxa-3,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 164813193) has the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. Its IUPAC name is 8-oxa-3,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 8-oxa-3,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 164813193 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 8-oxa-3,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1cc2oc3nccnc3c2cn1 |
| InChI | InChI=1S/C9H5N3O/c1-2-10-5-6-7(1)13-9-8(6)11-3-4-12-9/h1-5H |
| InChIKey | ZZHZFMSXGJKHJP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |