C42H24N4O3S2 — CID 164813456
5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-dithiophen-2-yl-8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5,11-diamine (PubChem CID 164813456) has the molecular formula C42H24N4O3S2 and a molecular weight of 696.81 g/mol. Its IUPAC name is 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-dithiophen-2-yl-8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5,11-diamine.
| Compound Name | 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-dithiophen-2-yl-8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5,11-diamine |
|---|---|
| PubChem CID | 164813456 |
| Molecular Formula | C42H24N4O3S2 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.13 |
| IUPAC Name | 5-N,11-N-di(dibenzofuran-3-yl)-5-N,11-N-dithiophen-2-yl-8-oxa-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5,11-diamine |
| SMILES | c1csc(N(c2ccc3c(c2)oc2ccccc23)c2cnc3c(c2)oc2nc(N(c4ccc5c(c4)oc4ccccc45)c4cccs4)ccc23)c1 |
| InChI | InChI=1S/C42H24N4O3S2/c1-3-9-33-28(7-1)30-15-13-25(21-35(30)47-33)45(39-11-5-19-50-39)27-23-37-41(43-24-27)32-17-18-38(44-42(32)49-37)46(40-12-6-20-51-40)26-14-16-31-29-8-2-4-10-34(29)48-36(31)22-26/h1-24H |
| InChIKey | YDLIZUCAMSPHDK-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |