C51H93N3O4 — CID 164814196
[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropyl]-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]amino]propanoate (PubChem CID 164814196) has the molecular formula C51H93N3O4 and a molecular weight of 812.32 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropyl]-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]amino]propanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropyl]-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 164814196 |
| Molecular Formula | C51H93N3O4 |
| Molecular Weight | 812.32 g/mol |
| Exact Mass | 811.72 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropyl]-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]amino]propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CCN(CCC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)CCN1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C51H93N3O4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44-57-50(55)38-40-53(42-43-54-46-48(3)52(5)49(4)47-54)41-39-51(56)58-45-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,48-49H,6-13,18-19,24-47H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | YHEVALRGAQFIJF-ZPPAUJSGSA-N |
| XLogP | 12.81 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.32 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|