C12H24N2O3 — CID 164818410
1-[(2S)-2-[(tert-butylamino)methyl]morpholin-4-yl]-2-methoxyethanone (PubChem CID 164818410) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-[(2S)-2-[(tert-butylamino)methyl]morpholin-4-yl]-2-methoxyethanone.
| Compound Name | 1-[(2S)-2-[(tert-butylamino)methyl]morpholin-4-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 164818410 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-[(2S)-2-[(tert-butylamino)methyl]morpholin-4-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCO[C@@H](CNC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24N2O3/c1-12(2,3)13-7-10-8-14(5-6-17-10)11(15)9-16-4/h10,13H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | DJIVTYQLRVDEMN-JTQLQIEISA-N |
| XLogP | 0.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |