C54H28N6S2 — CID 164819630
2,6-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-4-isocyano-3,5-dipyridin-2-ylbenzonitrile (PubChem CID 164819630) has the molecular formula C54H28N6S2 and a molecular weight of 824.99 g/mol. Its IUPAC name is 2,6-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-4-isocyano-3,5-dipyridin-2-ylbenzonitrile.
| Compound Name | 2,6-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-4-isocyano-3,5-dipyridin-2-ylbenzonitrile |
|---|---|
| PubChem CID | 164819630 |
| Molecular Formula | C54H28N6S2 |
| Molecular Weight | 824.99 g/mol |
| Exact Mass | 824.18 |
| IUPAC Name | 2,6-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-4-isocyano-3,5-dipyridin-2-ylbenzonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccn2)c(-n2c3ccccc3c3ccc4c5ccccc5sc4c32)c(C#N)c(-n2c3ccccc3c3ccc4c5ccccc5sc4c32)c1-c1ccccn1 |
| InChI | InChI=1S/C54H28N6S2/c1-56-48-46(40-18-10-12-28-57-40)49(59-42-20-6-2-14-31(42)35-24-26-37-33-16-4-8-22-44(33)61-53(37)51(35)59)39(30-55)50(47(48)41-19-11-13-29-58-41)60-43-21-7-3-15-32(43)36-25-27-38-34-17-5-9-23-45(34)62-54(38)52(36)60/h2-29H |
| InChIKey | ZBLLQELYYYQKBZ-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.99 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|