C46H26N4S2 — CID 164819836
4,5-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-2-isocyano-3,6-dimethylbenzonitrile (PubChem CID 164819836) has the molecular formula C46H26N4S2 and a molecular weight of 698.88 g/mol. Its IUPAC name is 4,5-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-2-isocyano-3,6-dimethylbenzonitrile.
| Compound Name | 4,5-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-2-isocyano-3,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 164819836 |
| Molecular Formula | C46H26N4S2 |
| Molecular Weight | 698.88 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | 4,5-bis([1]benzothiolo[2,3-a]carbazol-12-yl)-2-isocyano-3,6-dimethylbenzonitrile |
| SMILES | [C-]#[N+]c1c(C)c(-n2c3ccccc3c3ccc4c5ccccc5sc4c32)c(-n2c3ccccc3c3ccc4c5ccccc5sc4c32)c(C)c1C#N |
| InChI | InChI=1S/C46H26N4S2/c1-25-35(24-47)40(48-3)26(2)42(50-37-17-9-5-13-28(37)32-21-23-34-30-15-7-11-19-39(30)52-46(34)44(32)50)41(25)49-36-16-8-4-12-27(36)31-20-22-33-29-14-6-10-18-38(29)51-45(33)43(31)49/h4-23H,1-2H3 |
| InChIKey | YJQOIVMJKQLGOW-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.88 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|