C13H10ClF3N2O — CID 164819969
5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole-3-carbonyl chloride (PubChem CID 164819969) has the molecular formula C13H10ClF3N2O and a molecular weight of 302.68 g/mol. Its IUPAC name is 5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole-3-carbonyl chloride.
| Compound Name | 5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 164819969 |
| Molecular Formula | C13H10ClF3N2O |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(CCc2ccc(C(F)(F)F)cc2)[nH]n1 |
| InChI | InChI=1S/C13H10ClF3N2O/c14-12(20)11-7-10(18-19-11)6-3-8-1-4-9(5-2-8)13(15,16)17/h1-2,4-5,7H,3,6H2,(H,18,19) |
| InChIKey | DNEAHCNITJTWED-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|