C20H26BN3O3S — CID 164820083
methyl-[4-[(E)-N-[(4-methylphenyl)sulfonylamino]-C-phenylcarbonimidoyl]piperidin-1-yl]borinic acid (PubChem CID 164820083) has the molecular formula C20H26BN3O3S and a molecular weight of 399.33 g/mol. Its IUPAC name is methyl-[4-[(E)-N-[(4-methylphenyl)sulfonylamino]-C-phenylcarbonimidoyl]piperidin-1-yl]borinic acid.
| Compound Name | methyl-[4-[(E)-N-[(4-methylphenyl)sulfonylamino]-C-phenylcarbonimidoyl]piperidin-1-yl]borinic acid |
|---|---|
| PubChem CID | 164820083 |
| Molecular Formula | C20H26BN3O3S |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl-[4-[(E)-N-[(4-methylphenyl)sulfonylamino]-C-phenylcarbonimidoyl]piperidin-1-yl]borinic acid |
| SMILES | CB(O)N1CCC(/C(=N\NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26BN3O3S/c1-16-8-10-19(11-9-16)28(26,27)23-22-20(17-6-4-3-5-7-17)18-12-14-24(15-13-18)21(2)25/h3-11,18,23,25H,12-15H2,1-2H3/b22-20- |
| InChIKey | LNAHOEXICGWSHP-XDOYNYLZSA-N |
| XLogP | 2.50 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|