C24H26ClNO6 — CID 164824214
2-[[3-[(E)-3-chloro-2-methoxy-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]-3-methylpentanoic acid (PubChem CID 164824214) has the molecular formula C24H26ClNO6 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-[[3-[(E)-3-chloro-2-methoxy-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]-3-methylpentanoic acid.
| Compound Name | 2-[[3-[(E)-3-chloro-2-methoxy-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 164824214 |
| Molecular Formula | C24H26ClNO6 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[[3-[(E)-3-chloro-2-methoxy-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(/N=C/c1cccc(OC(=O)/C(OC)=C(\Cl)c2cccc(OC)c2)c1)C(=O)O |
| InChI | InChI=1S/C24H26ClNO6/c1-5-15(2)21(23(27)28)26-14-16-8-6-11-19(12-16)32-24(29)22(31-4)20(25)17-9-7-10-18(13-17)30-3/h6-15,21H,5H2,1-4H3,(H,27,28)/b22-20+,26-14+ |
| InChIKey | VONBOADCQXBBBE-HTOWZWDHSA-N |
| XLogP | 4.77 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|