C33H27GeN3O — CID 164825640
[6-(1,5-diphenylimidazo[4,5-b]pyridin-2-yl)dibenzofuran-3-yl]-trimethylgermane (PubChem CID 164825640) has the molecular formula C33H27GeN3O and a molecular weight of 554.21 g/mol. Its IUPAC name is [6-(1,5-diphenylimidazo[4,5-b]pyridin-2-yl)dibenzofuran-3-yl]-trimethylgermane.
| Compound Name | [6-(1,5-diphenylimidazo[4,5-b]pyridin-2-yl)dibenzofuran-3-yl]-trimethylgermane |
|---|---|
| PubChem CID | 164825640 |
| Molecular Formula | C33H27GeN3O |
| Molecular Weight | 554.21 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | [6-(1,5-diphenylimidazo[4,5-b]pyridin-2-yl)dibenzofuran-3-yl]-trimethylgermane |
| SMILES | C[Ge](C)(C)c1ccc2c(c1)oc1c(-c3nc4nc(-c5ccccc5)ccc4n3-c3ccccc3)cccc12 |
| InChI | InChI=1S/C33H27GeN3O/c1-34(2,3)23-17-18-25-26-15-10-16-27(31(26)38-30(25)21-23)33-36-32-29(37(33)24-13-8-5-9-14-24)20-19-28(35-32)22-11-6-4-7-12-22/h4-21H,1-3H3 |
| InChIKey | KGQKCULNQSTRHI-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.21 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |