C28H23N3O — CID 164826557
6-tert-butyl-2-dibenzofuran-4-yl-1-phenylimidazo[4,5-b]pyridine (PubChem CID 164826557) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 6-tert-butyl-2-dibenzofuran-4-yl-1-phenylimidazo[4,5-b]pyridine.
| Compound Name | 6-tert-butyl-2-dibenzofuran-4-yl-1-phenylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 164826557 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 6-tert-butyl-2-dibenzofuran-4-yl-1-phenylimidazo[4,5-b]pyridine |
| SMILES | CC(C)(C)c1cnc2nc(-c3cccc4c3oc3ccccc34)n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C28H23N3O/c1-28(2,3)18-16-23-26(29-17-18)30-27(31(23)19-10-5-4-6-11-19)22-14-9-13-21-20-12-7-8-15-24(20)32-25(21)22/h4-17H,1-3H3 |
| InChIKey | FPGHOECYRVABOR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |