C31H31N3OSi — CID 164825170
[6-(6-tert-butyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]-trimethylsilane (PubChem CID 164825170) has the molecular formula C31H31N3OSi and a molecular weight of 489.70 g/mol. Its IUPAC name is [6-(6-tert-butyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]-trimethylsilane.
| Compound Name | [6-(6-tert-butyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164825170 |
| Molecular Formula | C31H31N3OSi |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [6-(6-tert-butyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]-trimethylsilane |
| SMILES | CC(C)(C)c1cc2c(cn1)nc(-c1cccc3c1oc1cc([Si](C)(C)C)ccc13)n2-c1ccccc1 |
| InChI | InChI=1S/C31H31N3OSi/c1-31(2,3)28-18-26-25(19-32-28)33-30(34(26)20-11-8-7-9-12-20)24-14-10-13-23-22-16-15-21(36(4,5)6)17-27(22)35-29(23)24/h7-19H,1-6H3 |
| InChIKey | QAPHPQDROXIWJG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|