C28H25N3OSi — CID 164826478
trimethyl-[6-(7-methyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]silane (PubChem CID 164826478) has the molecular formula C28H25N3OSi and a molecular weight of 447.61 g/mol. Its IUPAC name is trimethyl-[6-(7-methyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]silane.
| Compound Name | trimethyl-[6-(7-methyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]silane |
|---|---|
| PubChem CID | 164826478 |
| Molecular Formula | C28H25N3OSi |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | trimethyl-[6-(7-methyl-1-phenylimidazo[4,5-c]pyridin-2-yl)dibenzofuran-3-yl]silane |
| SMILES | Cc1cncc2nc(-c3cccc4c3oc3cc([Si](C)(C)C)ccc34)n(-c3ccccc3)c12 |
| InChI | InChI=1S/C28H25N3OSi/c1-18-16-29-17-24-26(18)31(19-9-6-5-7-10-19)28(30-24)23-12-8-11-22-21-14-13-20(33(2,3)4)15-25(21)32-27(22)23/h5-17H,1-4H3 |
| InChIKey | RFVJXWZQNSUFIJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|