C39H26N2O — CID 170520882
7-(trideuteriomethyl)-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]-1-triphenylen-2-ylbenzimidazole (PubChem CID 170520882) has the molecular formula C39H26N2O and a molecular weight of 544.69 g/mol. Its IUPAC name is 7-(trideuteriomethyl)-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]-1-triphenylen-2-ylbenzimidazole.
| Compound Name | 7-(trideuteriomethyl)-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]-1-triphenylen-2-ylbenzimidazole |
|---|---|
| PubChem CID | 170520882 |
| Molecular Formula | C39H26N2O |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 7-(trideuteriomethyl)-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]-1-triphenylen-2-ylbenzimidazole |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)oc1c(-c3nc4cccc(C([2H])([2H])[2H])c4n3-c3ccc4c5ccccc5c5ccccc5c4c3)cccc12 |
| InChI | InChI=1S/C39H26N2O/c1-23-17-19-31-32-14-8-15-33(38(32)42-36(31)21-23)39-40-35-16-7-9-24(2)37(35)41(39)25-18-20-30-28-12-4-3-10-26(28)27-11-5-6-13-29(27)34(30)22-25/h3-22H,1-2H3/i1D3,2D3 |
| InChIKey | PSPHLMQQOZCBQX-WFGJKAKNSA-N |
| XLogP | 10.67 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|