C39H30IrN4O-2 — CID 164826366
2-[7-(2-deuteriopropan-2-yl)-3H-dibenzofuran-3-id-4-yl]-6-methyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine (PubChem CID 164826366) has the molecular formula C39H30IrN4O-2 and a molecular weight of 763.92 g/mol. Its IUPAC name is 2-[7-(2-deuteriopropan-2-yl)-3H-dibenzofuran-3-id-4-yl]-6-methyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-[7-(2-deuteriopropan-2-yl)-3H-dibenzofuran-3-id-4-yl]-6-methyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164826366 |
| Molecular Formula | C39H30IrN4O-2 |
| Molecular Weight | 763.92 g/mol |
| Exact Mass | 764.21 |
| IUPAC Name | 2-[7-(2-deuteriopropan-2-yl)-3H-dibenzofuran-3-id-4-yl]-6-methyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C(C)(C)c1ccc2c(c1)oc1c(-c3nc4cnc(C)cc4n3-c3ccccc3)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C28H22N3O.C11H8N.Ir/c1-17(2)19-12-13-21-22-10-7-11-23(27(22)32-26(21)15-19)28-30-24-16-29-18(3)14-25(24)31(28)20-8-5-4-6-9-20;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-10,12-17H,1-3H3;1-6,8-9H;/q2*-1;/i17D;; |
| InChIKey | PQXWFRXCEBBRHA-SMYCVDIJSA-N |
| XLogP | 9.77 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.92 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|