C43H34IrN4OSi-2 — CID 164826382
iridium;6-methyl-2-(9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl)-1-phenylimidazo[4,5-c]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 164826382) has the molecular formula C43H34IrN4OSi-2 and a molecular weight of 843.08 g/mol. Its IUPAC name is iridium;6-methyl-2-(9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl)-1-phenylimidazo[4,5-c]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;6-methyl-2-(9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl)-1-phenylimidazo[4,5-c]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 164826382 |
| Molecular Formula | C43H34IrN4OSi-2 |
| Molecular Weight | 843.08 g/mol |
| Exact Mass | 843.21 |
| IUPAC Name | iridium;6-methyl-2-(9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl)-1-phenylimidazo[4,5-c]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc2c(cn1)nc(-c1[c-]ccc3c1oc1c4ccccc4ccc31)n2-c1ccccc1.[Ir] |
| InChI | InChI=1S/C29H18N3O.C14H16NSi.Ir/c1-18-16-26-25(17-30-18)31-29(32(26)20-9-3-2-4-10-20)24-13-7-12-22-23-15-14-19-8-5-6-11-21(19)27(23)33-28(22)24;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h2-12,14-17H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KVOAFAXPKKHYFD-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.08 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|