C23H15N5O — CID 164827351
2-methyl-8-(7-phenylpurin-8-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 164827351) has the molecular formula C23H15N5O and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-methyl-8-(7-phenylpurin-8-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-methyl-8-(7-phenylpurin-8-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 164827351 |
| Molecular Formula | C23H15N5O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-methyl-8-(7-phenylpurin-8-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3nc4ncncc4n3-c3ccccc3)cccc12 |
| InChI | InChI=1S/C23H15N5O/c1-14-10-11-17-16-8-5-9-18(20(16)29-23(17)26-14)22-27-21-19(12-24-13-25-21)28(22)15-6-3-2-4-7-15/h2-13H,1H3 |
| InChIKey | PINCABRSQJRILP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |