C20H21N7O3 — CID 164832214
8-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-5-(trideuteriomethyl)-10-oxa-2,5,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-trien-6-one (PubChem CID 164832214) has the molecular formula C20H21N7O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 8-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-5-(trideuteriomethyl)-10-oxa-2,5,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-trien-6-one.
| Compound Name | 8-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-5-(trideuteriomethyl)-10-oxa-2,5,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-trien-6-one |
|---|---|
| PubChem CID | 164832214 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 8-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-5-(trideuteriomethyl)-10-oxa-2,5,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-trien-6-one |
| SMILES | [2H]C([2H])([2H])N1Cc2nc3c(c(Nc4cccc(-c5ncn(C)n5)c4OC)c2C1=O)OCCN3 |
| InChI | InChI=1S/C20H21N7O3/c1-26-9-13-14(20(26)28)15(17-19(24-13)21-7-8-30-17)23-12-6-4-5-11(16(12)29-3)18-22-10-27(2)25-18/h4-6,10H,7-9H2,1-3H3,(H2,21,23,24)/i1D3 |
| InChIKey | CGMISFWEZDSPCA-FIBGUPNXSA-N |
| XLogP | 2.02 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |