C37H23N4O3Pt-3 — CID 164833962
CID 164833962 (PubChem CID 164833962) has the molecular formula C37H23N4O3Pt-3 and a molecular weight of 771.72 g/mol.
| Compound Name | CID 164833962 |
|---|---|
| PubChem CID | 164833962 |
| Molecular Formula | C37H23N4O3Pt-3 |
| Molecular Weight | 771.72 g/mol |
| Exact Mass | 771.17 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cnc(-n3c4[c-]c(Oc5[c-]c(C6=COC7=C8OC=CN8[CH-]N67)ccc5)ccc4c4ccccc43)cc2C)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C37H23N4O3.Pt/c1-24-18-35(38-21-31(24)25-8-3-2-4-9-25)41-32-13-6-5-12-29(32)30-15-14-28(20-33(30)41)44-27-11-7-10-26(19-27)34-22-43-37-36-39(16-17-42-36)23-40(34)37;/h2-18,21-23H,1H3;/q-3;/i2D,3D,4D,8D,9D; |
| InChIKey | MIAXBFQXHRXRSG-GVEGKVHKSA-N |
| XLogP | 8.24 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.72 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|