C61H47N4OPt-3 — CID 177105354
CID 177105354 (PubChem CID 177105354) has the molecular formula C61H47N4OPt-3 and a molecular weight of 1055.20 g/mol.
| Compound Name | CID 177105354 |
|---|---|
| PubChem CID | 177105354 |
| Molecular Formula | C61H47N4OPt-3 |
| Molecular Weight | 1055.20 g/mol |
| Exact Mass | 1054.39 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cnc(-n3c4[c-]c(Oc5[c-]c(N6[CH-]n7c8c(C)cccc8c8cc(C)ccc8c8ccccc8c8cccc6c87)ccc5)ccc4c4cc(C(C)(C)C)ccc43)cc2C([2H])([2H])[2H])c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C61H47N4O.Pt/c1-38-25-28-48-46-20-10-11-21-47(46)50-23-14-24-56-60(50)64(59-39(2)15-12-22-51(59)52(48)31-38)37-63(56)43-18-13-19-44(34-43)66-45-27-29-49-53-33-42(61(4,5)6)26-30-55(53)65(57(49)35-45)58-32-40(3)54(36-62-58)41-16-8-7-9-17-41;/h7-33,36-37H,1-6H3;/q-3;/i3D3,7D,8D,9D,16D,17D; |
| InChIKey | YJKQWWYEUFZZPP-SCOWPXPOSA-N |
| XLogP | 16.12 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.20 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|